C26H29N3O4 — CID 44590157
N-[(1S)-7-oxo-1-(5-phenyl-1H-imidazol-2-yl)octyl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide (PubChem CID 44590157) has the molecular formula C26H29N3O4 and a molecular weight of 447.54 g/mol. Its IUPAC name is N-[(1S)-7-oxo-1-(5-phenyl-1H-imidazol-2-yl)octyl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide.
| Compound Name | N-[(1S)-7-oxo-1-(5-phenyl-1H-imidazol-2-yl)octyl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide |
|---|---|
| PubChem CID | 44590157 |
| Molecular Formula | C26H29N3O4 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | N-[(1S)-7-oxo-1-(5-phenyl-1H-imidazol-2-yl)octyl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide |
| SMILES | CC(=O)CCCCC[C@H](NC(=O)c1ccc2c(c1)OCCO2)c1ncc(-c2ccccc2)[nH]1 |
| InChI | InChI=1S/C26H29N3O4/c1-18(30)8-4-2-7-11-21(25-27-17-22(28-25)19-9-5-3-6-10-19)29-26(31)20-12-13-23-24(16-20)33-15-14-32-23/h3,5-6,9-10,12-13,16-17,21H,2,4,7-8,11,14-15H2,1H3,(H,27,28)(H,29,31)/t21-/m0/s1 |
| InChIKey | FGOREKAQPPMVFS-NRFANRHFSA-N |
| XLogP | 4.86 |
| TPSA | 93.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|