C21H24N4O2S — CID 44590158
N-[(1S)-7-oxo-1-(5-phenyl-1H-imidazol-2-yl)octyl]-1,3-thiazole-5-carboxamide (PubChem CID 44590158) has the molecular formula C21H24N4O2S and a molecular weight of 396.52 g/mol. Its IUPAC name is N-[(1S)-7-oxo-1-(5-phenyl-1H-imidazol-2-yl)octyl]-1,3-thiazole-5-carboxamide.
| Compound Name | N-[(1S)-7-oxo-1-(5-phenyl-1H-imidazol-2-yl)octyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 44590158 |
| Molecular Formula | C21H24N4O2S |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | N-[(1S)-7-oxo-1-(5-phenyl-1H-imidazol-2-yl)octyl]-1,3-thiazole-5-carboxamide |
| SMILES | CC(=O)CCCCC[C@H](NC(=O)c1cncs1)c1ncc(-c2ccccc2)[nH]1 |
| InChI | InChI=1S/C21H24N4O2S/c1-15(26)8-4-2-7-11-17(25-21(27)19-13-22-14-28-19)20-23-12-18(24-20)16-9-5-3-6-10-16/h3,5-6,9-10,12-14,17H,2,4,7-8,11H2,1H3,(H,23,24)(H,25,27)/t17-/m0/s1 |
| InChIKey | KJMYNXCUPUOUFZ-KRWDZBQOSA-N |
| XLogP | 4.54 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|