C23H22N6O3S — CID 44590210
N-(2-amino-5-thiophen-2-ylphenyl)-6-(2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl)pyridine-3-carboxamide (PubChem CID 44590210) has the molecular formula C23H22N6O3S and a molecular weight of 462.54 g/mol. Its IUPAC name is N-(2-amino-5-thiophen-2-ylphenyl)-6-(2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl)pyridine-3-carboxamide.
| Compound Name | N-(2-amino-5-thiophen-2-ylphenyl)-6-(2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 44590210 |
| Molecular Formula | C23H22N6O3S |
| Molecular Weight | 462.54 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | N-(2-amino-5-thiophen-2-ylphenyl)-6-(2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl)pyridine-3-carboxamide |
| SMILES | Nc1ccc(-c2cccs2)cc1NC(=O)c1ccc(N2CCC3(CC2)NC(=O)NC3=O)nc1 |
| InChI | InChI=1S/C23H22N6O3S/c24-16-5-3-14(18-2-1-11-33-18)12-17(16)26-20(30)15-4-6-19(25-13-15)29-9-7-23(8-10-29)21(31)27-22(32)28-23/h1-6,11-13H,7-10,24H2,(H,26,30)(H2,27,28,31,32) |
| InChIKey | PLMLXVWSKONFFN-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 129.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.54 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|