C35H35N7O5 — CID 44590462
N-[[(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-[(4-phenoxyphenyl)methylamino]purin-9-yl]oxolan-2-yl]methyl]-4-(1H-indol-3-yl)butanamide (PubChem CID 44590462) has the molecular formula C35H35N7O5 and a molecular weight of 633.71 g/mol. Its IUPAC name is N-[[(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-[(4-phenoxyphenyl)methylamino]purin-9-yl]oxolan-2-yl]methyl]-4-(1H-indol-3-yl)butanamide.
| Compound Name | N-[[(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-[(4-phenoxyphenyl)methylamino]purin-9-yl]oxolan-2-yl]methyl]-4-(1H-indol-3-yl)butanamide |
|---|---|
| PubChem CID | 44590462 |
| Molecular Formula | C35H35N7O5 |
| Molecular Weight | 633.71 g/mol |
| Exact Mass | 633.27 |
| IUPAC Name | N-[[(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-[(4-phenoxyphenyl)methylamino]purin-9-yl]oxolan-2-yl]methyl]-4-(1H-indol-3-yl)butanamide |
| SMILES | O=C(CCCc1c[nH]c2ccccc12)NC[C@H]1O[C@@H](n2cnc3c(NCc4ccc(Oc5ccccc5)cc4)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C35H35N7O5/c43-29(12-6-7-23-18-36-27-11-5-4-10-26(23)27)37-19-28-31(44)32(45)35(47-28)42-21-41-30-33(39-20-40-34(30)42)38-17-22-13-15-25(16-14-22)46-24-8-2-1-3-9-24/h1-5,8-11,13-16,18,20-21,28,31-32,35-36,44-45H,6-7,12,17,19H2,(H,37,43)(H,38,39,40)/t28-,31-,32-,35-/m1/s1 |
| InChIKey | FMQYWLMLRIKECT-CQFMLMEWSA-N |
| XLogP | 4.47 |
| TPSA | 159.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.71 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |