C42H36N8O5 — CID 44590525
N-[[(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-[(4-phenoxyphenyl)methylamino]purin-9-yl]oxolan-2-yl]methyl]-1-(naphthalen-1-ylmethyl)benzimidazole-5-carboxamide (PubChem CID 44590525) has the molecular formula C42H36N8O5 and a molecular weight of 732.80 g/mol. Its IUPAC name is N-[[(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-[(4-phenoxyphenyl)methylamino]purin-9-yl]oxolan-2-yl]methyl]-1-(naphthalen-1-ylmethyl)benzimidazole-5-carboxamide.
| Compound Name | N-[[(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-[(4-phenoxyphenyl)methylamino]purin-9-yl]oxolan-2-yl]methyl]-1-(naphthalen-1-ylmethyl)benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 44590525 |
| Molecular Formula | C42H36N8O5 |
| Molecular Weight | 732.80 g/mol |
| Exact Mass | 732.28 |
| IUPAC Name | N-[[(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-[(4-phenoxyphenyl)methylamino]purin-9-yl]oxolan-2-yl]methyl]-1-(naphthalen-1-ylmethyl)benzimidazole-5-carboxamide |
| SMILES | O=C(NC[C@H]1O[C@@H](n2cnc3c(NCc4ccc(Oc5ccccc5)cc4)ncnc32)[C@H](O)[C@@H]1O)c1ccc2c(c1)ncn2Cc1cccc2ccccc12 |
| InChI | InChI=1S/C42H36N8O5/c51-37-35(21-44-41(53)28-15-18-34-33(19-28)47-24-49(34)22-29-9-6-8-27-7-4-5-12-32(27)29)55-42(38(37)52)50-25-48-36-39(45-23-46-40(36)50)43-20-26-13-16-31(17-14-26)54-30-10-2-1-3-11-30/h1-19,23-25,35,37-38,42,51-52H,20-22H2,(H,44,53)(H,43,45,46)/t35-,37-,38-,42-/m1/s1 |
| InChIKey | NCTYSRHEWGXFQO-GNECSJIWSA-N |
| XLogP | 5.83 |
| TPSA | 161.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.80 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |