C35H36N8O6 — CID 44590532
1-butyl-N-[[(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-[(4-phenoxyphenyl)methylamino]purin-9-yl]oxolan-2-yl]methyl]-2-oxo-3H-benzimidazole-5-carboxamide (PubChem CID 44590532) has the molecular formula C35H36N8O6 and a molecular weight of 664.72 g/mol. Its IUPAC name is 1-butyl-N-[[(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-[(4-phenoxyphenyl)methylamino]purin-9-yl]oxolan-2-yl]methyl]-2-oxo-3H-benzimidazole-5-carboxamide.
| Compound Name | 1-butyl-N-[[(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-[(4-phenoxyphenyl)methylamino]purin-9-yl]oxolan-2-yl]methyl]-2-oxo-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 44590532 |
| Molecular Formula | C35H36N8O6 |
| Molecular Weight | 664.72 g/mol |
| Exact Mass | 664.28 |
| IUPAC Name | 1-butyl-N-[[(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-[(4-phenoxyphenyl)methylamino]purin-9-yl]oxolan-2-yl]methyl]-2-oxo-3H-benzimidazole-5-carboxamide |
| SMILES | CCCCn1c(=O)[nH]c2cc(C(=O)NC[C@H]3O[C@@H](n4cnc5c(NCc6ccc(Oc7ccccc7)cc6)ncnc54)[C@H](O)[C@@H]3O)ccc21 |
| InChI | InChI=1S/C35H36N8O6/c1-2-3-15-42-26-14-11-22(16-25(26)41-35(42)47)33(46)37-18-27-29(44)30(45)34(49-27)43-20-40-28-31(38-19-39-32(28)43)36-17-21-9-12-24(13-10-21)48-23-7-5-4-6-8-23/h4-14,16,19-20,27,29-30,34,44-45H,2-3,15,17-18H2,1H3,(H,37,46)(H,41,47)(H,36,38,39)/t27-,29-,30-,34-/m1/s1 |
| InChIKey | XRBDFJZVZRWZOH-WIFIACMTSA-N |
| XLogP | 3.72 |
| TPSA | 181.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.72 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |