C36H50N4O3 — CID 44590665
1-[4-amino-2,6-di(propan-2-yl)phenyl]-3-[[1-(2-butoxyphenyl)-4-(3-methoxyphenyl)piperidin-4-yl]methyl]urea (PubChem CID 44590665) has the molecular formula C36H50N4O3 and a molecular weight of 586.82 g/mol. Its IUPAC name is 1-[4-amino-2,6-di(propan-2-yl)phenyl]-3-[[1-(2-butoxyphenyl)-4-(3-methoxyphenyl)piperidin-4-yl]methyl]urea.
| Compound Name | 1-[4-amino-2,6-di(propan-2-yl)phenyl]-3-[[1-(2-butoxyphenyl)-4-(3-methoxyphenyl)piperidin-4-yl]methyl]urea |
|---|---|
| PubChem CID | 44590665 |
| Molecular Formula | C36H50N4O3 |
| Molecular Weight | 586.82 g/mol |
| Exact Mass | 586.39 |
| IUPAC Name | 1-[4-amino-2,6-di(propan-2-yl)phenyl]-3-[[1-(2-butoxyphenyl)-4-(3-methoxyphenyl)piperidin-4-yl]methyl]urea |
| SMILES | CCCCOc1ccccc1N1CCC(CNC(=O)Nc2c(C(C)C)cc(N)cc2C(C)C)(c2cccc(OC)c2)CC1 |
| InChI | InChI=1S/C36H50N4O3/c1-7-8-20-43-33-15-10-9-14-32(33)40-18-16-36(17-19-40,27-12-11-13-29(21-27)42-6)24-38-35(41)39-34-30(25(2)3)22-28(37)23-31(34)26(4)5/h9-15,21-23,25-26H,7-8,16-20,24,37H2,1-6H3,(H2,38,39,41) |
| InChIKey | MVQPUZAKSCLKGK-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.82 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|