C35H36N8O4 — CID 44590672
3-acridin-9-yl-N-[5-[[5-[3-(dimethylamino)propylcarbamoyl]-1-methylpyrrol-3-yl]carbamoyl]-1-methylpyrrol-3-yl]-5-methyl-1,2-oxazole-4-carboxamide (PubChem CID 44590672) has the molecular formula C35H36N8O4 and a molecular weight of 632.73 g/mol. Its IUPAC name is 3-acridin-9-yl-N-[5-[[5-[3-(dimethylamino)propylcarbamoyl]-1-methylpyrrol-3-yl]carbamoyl]-1-methylpyrrol-3-yl]-5-methyl-1,2-oxazole-4-carboxamide.
| Compound Name | 3-acridin-9-yl-N-[5-[[5-[3-(dimethylamino)propylcarbamoyl]-1-methylpyrrol-3-yl]carbamoyl]-1-methylpyrrol-3-yl]-5-methyl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 44590672 |
| Molecular Formula | C35H36N8O4 |
| Molecular Weight | 632.73 g/mol |
| Exact Mass | 632.29 |
| IUPAC Name | 3-acridin-9-yl-N-[5-[[5-[3-(dimethylamino)propylcarbamoyl]-1-methylpyrrol-3-yl]carbamoyl]-1-methylpyrrol-3-yl]-5-methyl-1,2-oxazole-4-carboxamide |
| SMILES | Cc1onc(-c2c3ccccc3nc3ccccc23)c1C(=O)Nc1cc(C(=O)Nc2cc(C(=O)NCCCN(C)C)n(C)c2)n(C)c1 |
| InChI | InChI=1S/C35H36N8O4/c1-21-30(32(40-47-21)31-24-11-6-8-13-26(24)39-27-14-9-7-12-25(27)31)35(46)38-23-18-29(43(5)20-23)34(45)37-22-17-28(42(4)19-22)33(44)36-15-10-16-41(2)3/h6-9,11-14,17-20H,10,15-16H2,1-5H3,(H,36,44)(H,37,45)(H,38,46) |
| InChIKey | UXSICKNVTSVGKK-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 139.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.73 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|