C21H23NO2 — CID 44591124
3-[(1E,4E)-5-(3-hydroxy-2,6,6-trimethylcyclohexen-1-yl)-3-oxopenta-1,4-dienyl]benzonitrile (PubChem CID 44591124) has the molecular formula C21H23NO2 and a molecular weight of 321.42 g/mol. Its IUPAC name is 3-[(1E,4E)-5-(3-hydroxy-2,6,6-trimethylcyclohexen-1-yl)-3-oxopenta-1,4-dienyl]benzonitrile.
| Compound Name | 3-[(1E,4E)-5-(3-hydroxy-2,6,6-trimethylcyclohexen-1-yl)-3-oxopenta-1,4-dienyl]benzonitrile |
|---|---|
| PubChem CID | 44591124 |
| Molecular Formula | C21H23NO2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | 3-[(1E,4E)-5-(3-hydroxy-2,6,6-trimethylcyclohexen-1-yl)-3-oxopenta-1,4-dienyl]benzonitrile |
| SMILES | CC1=C(/C=C/C(=O)/C=C/c2cccc(C#N)c2)C(C)(C)CCC1O |
| InChI | InChI=1S/C21H23NO2/c1-15-19(21(2,3)12-11-20(15)24)10-9-18(23)8-7-16-5-4-6-17(13-16)14-22/h4-10,13,20,24H,11-12H2,1-3H3/b8-7+,10-9+ |
| InChIKey | VLGLLRBCSNVMTP-XBLVEGMJSA-N |
| XLogP | 4.19 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|