About 4-[5-[5-(2,2-dimethylpropyl)-1H-pyrazol-3-yl]-2-methylphenyl]sulfonylmorpholine
4-[5-[5-(2,2-dimethylpropyl)-1H-pyrazol-3-yl]-2-methylphenyl]sulfonylmorpholine (PubChem CID 44591241) has the molecular formula C19H27N3O3S
and a molecular weight of 377.51 g/mol. Its IUPAC name is 4-[5-[5-(2,2-dimethylpropyl)-1H-pyrazol-3-yl]-2-methylphenyl]sulfonylmorpholine.
Molecular Properties
| Compound Name | 4-[5-[5-(2,2-dimethylpropyl)-1H-pyrazol-3-yl]-2-methylphenyl]sulfonylmorpholine |
| PubChem CID | 44591241 |
| Molecular Formula | C19H27N3O3S |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | 4-[5-[5-(2,2-dimethylpropyl)-1H-pyrazol-3-yl]-2-methylphenyl]sulfonylmorpholine |
| SMILES | Cc1ccc(-c2cc(CC(C)(C)C)[nH]n2)cc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C19H27N3O3S/c1-14-5-6-15(17-12-16(20-21-17)13-19(2,3)4)11-18(14)26(23,24)22-7-9-25-10-8-22/h5-6,11-12H,7-10,13H2,1-4H3,(H,20,21) |
| InChIKey | PULNPRPJQNBQTH-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[5-[5-(2,2-dimethylpropyl)-1H-pyrazol-3-yl]-2-methylphenyl]sulfonylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-[5-(2,2-dimethylpropyl)-1H-pyrazol-3-yl]-2-methylphenyl]sulfonylmorpholine?
The IUPAC name of 4-[5-[5-(2,2-dimethylpropyl)-1H-pyrazol-3-yl]-2-methylphenyl]sulfonylmorpholine (CID 44591241) is 4-[5-[5-(2,2-dimethylpropyl)-1H-pyrazol-3-yl]-2-methylphenyl]sulfonylmorpholine.
What is the SMILES notation for 4-[5-[5-(2,2-dimethylpropyl)-1H-pyrazol-3-yl]-2-methylphenyl]sulfonylmorpholine?
The canonical SMILES for 4-[5-[5-(2,2-dimethylpropyl)-1H-pyrazol-3-yl]-2-methylphenyl]sulfonylmorpholine is Cc1ccc(-c2cc(CC(C)(C)C)[nH]n2)cc1S(=O)(=O)N1CCOCC1.
What is the InChIKey of 4-[5-[5-(2,2-dimethylpropyl)-1H-pyrazol-3-yl]-2-methylphenyl]sulfonylmorpholine?
The InChIKey is PULNPRPJQNBQTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H27N3O3S/c1-14-5-6-15(17-12-16(20-21-17)13-19(2,3)4)11-18(14)26(23,24)22-7-9-25-10-8-22/h5-6,11-12H,7-10,13H2,1-4H3,(H,20,21).
What are the key properties of 4-[5-[5-(2,2-dimethylpropyl)-1H-pyrazol-3-yl]-2-methylphenyl]sulfonylmorpholine?
4-[5-[5-(2,2-dimethylpropyl)-1H-pyrazol-3-yl]-2-methylphenyl]sulfonylmorpholine has a molecular weight of 377.51 g/mol, XLogP of 2.99, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-[5-(2,2-dimethylpropyl)-1H-pyrazol-3-yl]-2-methylphenyl]sulfonylmorpholine is sourced from PubChem (CID 44591241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).