About N-cyclopropyl-4-[1-[2-(2,3-dihydro-1H-inden-2-yl)ethyl]piperidin-3-yl]pyrimidin-2-amine
N-cyclopropyl-4-[1-[2-(2,3-dihydro-1H-inden-2-yl)ethyl]piperidin-3-yl]pyrimidin-2-amine (PubChem CID 44591281) has the molecular formula C23H30N4
and a molecular weight of 362.52 g/mol. Its IUPAC name is N-cyclopropyl-4-[1-[2-(2,3-dihydro-1H-inden-2-yl)ethyl]piperidin-3-yl]pyrimidin-2-amine.
Molecular Properties
| Compound Name | N-cyclopropyl-4-[1-[2-(2,3-dihydro-1H-inden-2-yl)ethyl]piperidin-3-yl]pyrimidin-2-amine |
| PubChem CID | 44591281 |
| Molecular Formula | C23H30N4 |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | N-cyclopropyl-4-[1-[2-(2,3-dihydro-1H-inden-2-yl)ethyl]piperidin-3-yl]pyrimidin-2-amine |
| SMILES | c1ccc2c(c1)CC(CCN1CCCC(c3ccnc(NC4CC4)n3)C1)C2 |
| InChI | InChI=1S/C23H30N4/c1-2-5-19-15-17(14-18(19)4-1)10-13-27-12-3-6-20(16-27)22-9-11-24-23(26-22)25-21-7-8-21/h1-2,4-5,9,11,17,20-21H,3,6-8,10,12-16H2,(H,24,25,26) |
| InChIKey | OTGGRKWIRVAPBH-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-cyclopropyl-4-[1-[2-(2,3-dihydro-1H-inden-2-yl)ethyl]piperidin-3-yl]pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopropyl-4-[1-[2-(2,3-dihydro-1H-inden-2-yl)ethyl]piperidin-3-yl]pyrimidin-2-amine?
The IUPAC name of N-cyclopropyl-4-[1-[2-(2,3-dihydro-1H-inden-2-yl)ethyl]piperidin-3-yl]pyrimidin-2-amine (CID 44591281) is N-cyclopropyl-4-[1-[2-(2,3-dihydro-1H-inden-2-yl)ethyl]piperidin-3-yl]pyrimidin-2-amine.
What is the SMILES notation for N-cyclopropyl-4-[1-[2-(2,3-dihydro-1H-inden-2-yl)ethyl]piperidin-3-yl]pyrimidin-2-amine?
The canonical SMILES for N-cyclopropyl-4-[1-[2-(2,3-dihydro-1H-inden-2-yl)ethyl]piperidin-3-yl]pyrimidin-2-amine is c1ccc2c(c1)CC(CCN1CCCC(c3ccnc(NC4CC4)n3)C1)C2.
What is the InChIKey of N-cyclopropyl-4-[1-[2-(2,3-dihydro-1H-inden-2-yl)ethyl]piperidin-3-yl]pyrimidin-2-amine?
The InChIKey is OTGGRKWIRVAPBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H30N4/c1-2-5-19-15-17(14-18(19)4-1)10-13-27-12-3-6-20(16-27)22-9-11-24-23(26-22)25-21-7-8-21/h1-2,4-5,9,11,17,20-21H,3,6-8,10,12-16H2,(H,24,25,26).
What are the key properties of N-cyclopropyl-4-[1-[2-(2,3-dihydro-1H-inden-2-yl)ethyl]piperidin-3-yl]pyrimidin-2-amine?
N-cyclopropyl-4-[1-[2-(2,3-dihydro-1H-inden-2-yl)ethyl]piperidin-3-yl]pyrimidin-2-amine has a molecular weight of 362.52 g/mol, XLogP of 4.04, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopropyl-4-[1-[2-(2,3-dihydro-1H-inden-2-yl)ethyl]piperidin-3-yl]pyrimidin-2-amine is sourced from PubChem (CID 44591281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).