C9H16N5O5P — CID 44591299
[(2S)-1-(6-amino-6,7-dihydropurin-1-yl)-3-hydroxypropan-2-yl]oxymethylphosphonic acid (PubChem CID 44591299) has the molecular formula C9H16N5O5P and a molecular weight of 305.23 g/mol. Its IUPAC name is [(2S)-1-(6-amino-6,7-dihydropurin-1-yl)-3-hydroxypropan-2-yl]oxymethylphosphonic acid.
| Compound Name | [(2S)-1-(6-amino-6,7-dihydropurin-1-yl)-3-hydroxypropan-2-yl]oxymethylphosphonic acid |
|---|---|
| PubChem CID | 44591299 |
| Molecular Formula | C9H16N5O5P |
| Molecular Weight | 305.23 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | [(2S)-1-(6-amino-6,7-dihydropurin-1-yl)-3-hydroxypropan-2-yl]oxymethylphosphonic acid |
| SMILES | NC1c2[nH]cnc2N=CN1C[C@@H](CO)OCP(=O)(O)O |
| InChI | InChI=1S/C9H16N5O5P/c10-8-7-9(12-3-11-7)13-4-14(8)1-6(2-15)19-5-20(16,17)18/h3-4,6,8,15H,1-2,5,10H2,(H,11,12)(H2,16,17,18)/t6-,8?/m0/s1 |
| InChIKey | RTCNQXGRWPQXGC-UUEFVBAFSA-N |
| XLogP | -1.14 |
| TPSA | 157.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.23 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|