C18H16Cl2N4 — CID 44591370
5-chloro-N-[2-(2-chlorophenyl)ethyl]-6-methyl-2-pyridin-2-ylpyrimidin-4-amine (PubChem CID 44591370) has the molecular formula C18H16Cl2N4 and a molecular weight of 359.26 g/mol. Its IUPAC name is 5-chloro-N-[2-(2-chlorophenyl)ethyl]-6-methyl-2-pyridin-2-ylpyrimidin-4-amine.
| Compound Name | 5-chloro-N-[2-(2-chlorophenyl)ethyl]-6-methyl-2-pyridin-2-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 44591370 |
| Molecular Formula | C18H16Cl2N4 |
| Molecular Weight | 359.26 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | 5-chloro-N-[2-(2-chlorophenyl)ethyl]-6-methyl-2-pyridin-2-ylpyrimidin-4-amine |
| SMILES | Cc1nc(-c2ccccn2)nc(NCCc2ccccc2Cl)c1Cl |
| InChI | InChI=1S/C18H16Cl2N4/c1-12-16(20)18(22-11-9-13-6-2-3-7-14(13)19)24-17(23-12)15-8-4-5-10-21-15/h2-8,10H,9,11H2,1H3,(H,22,23,24) |
| InChIKey | LYFDMRFVCJJAIV-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.26 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |