About 4-(pyridin-4-ylmethylamino)-N-[3-(trifluoromethoxy)phenyl]-1,2-thiazole-3-carboxamide
4-(pyridin-4-ylmethylamino)-N-[3-(trifluoromethoxy)phenyl]-1,2-thiazole-3-carboxamide (PubChem CID 44591374) has the molecular formula C17H13F3N4O2S
and a molecular weight of 394.38 g/mol. Its IUPAC name is 4-(pyridin-4-ylmethylamino)-N-[3-(trifluoromethoxy)phenyl]-1,2-thiazole-3-carboxamide.
Molecular Properties
| Compound Name | 4-(pyridin-4-ylmethylamino)-N-[3-(trifluoromethoxy)phenyl]-1,2-thiazole-3-carboxamide |
| PubChem CID | 44591374 |
| Molecular Formula | C17H13F3N4O2S |
| Molecular Weight | 394.38 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | 4-(pyridin-4-ylmethylamino)-N-[3-(trifluoromethoxy)phenyl]-1,2-thiazole-3-carboxamide |
| SMILES | O=C(Nc1cccc(OC(F)(F)F)c1)c1nscc1NCc1ccncc1 |
| InChI | InChI=1S/C17H13F3N4O2S/c18-17(19,20)26-13-3-1-2-12(8-13)23-16(25)15-14(10-27-24-15)22-9-11-4-6-21-7-5-11/h1-8,10,22H,9H2,(H,23,25) |
| InChIKey | HPQJCFJZSWQYAT-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.38 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(pyridin-4-ylmethylamino)-N-[3-(trifluoromethoxy)phenyl]-1,2-thiazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(pyridin-4-ylmethylamino)-N-[3-(trifluoromethoxy)phenyl]-1,2-thiazole-3-carboxamide?
The IUPAC name of 4-(pyridin-4-ylmethylamino)-N-[3-(trifluoromethoxy)phenyl]-1,2-thiazole-3-carboxamide (CID 44591374) is 4-(pyridin-4-ylmethylamino)-N-[3-(trifluoromethoxy)phenyl]-1,2-thiazole-3-carboxamide.
What is the SMILES notation for 4-(pyridin-4-ylmethylamino)-N-[3-(trifluoromethoxy)phenyl]-1,2-thiazole-3-carboxamide?
The canonical SMILES for 4-(pyridin-4-ylmethylamino)-N-[3-(trifluoromethoxy)phenyl]-1,2-thiazole-3-carboxamide is O=C(Nc1cccc(OC(F)(F)F)c1)c1nscc1NCc1ccncc1.
What is the InChIKey of 4-(pyridin-4-ylmethylamino)-N-[3-(trifluoromethoxy)phenyl]-1,2-thiazole-3-carboxamide?
The InChIKey is HPQJCFJZSWQYAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13F3N4O2S/c18-17(19,20)26-13-3-1-2-12(8-13)23-16(25)15-14(10-27-24-15)22-9-11-4-6-21-7-5-11/h1-8,10,22H,9H2,(H,23,25).
What are the key properties of 4-(pyridin-4-ylmethylamino)-N-[3-(trifluoromethoxy)phenyl]-1,2-thiazole-3-carboxamide?
4-(pyridin-4-ylmethylamino)-N-[3-(trifluoromethoxy)phenyl]-1,2-thiazole-3-carboxamide has a molecular weight of 394.38 g/mol, XLogP of 4.30, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(pyridin-4-ylmethylamino)-N-[3-(trifluoromethoxy)phenyl]-1,2-thiazole-3-carboxamide is sourced from PubChem (CID 44591374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).