C21H22F4O — CID 44591411
(1E,4E)-1-[2-fluoro-5-(trifluoromethyl)phenyl]-5-(2,6,6-trimethylcyclohex-2-en-1-yl)penta-1,4-dien-3-one (PubChem CID 44591411) has the molecular formula C21H22F4O and a molecular weight of 366.40 g/mol. Its IUPAC name is (1E,4E)-1-[2-fluoro-5-(trifluoromethyl)phenyl]-5-(2,6,6-trimethylcyclohex-2-en-1-yl)penta-1,4-dien-3-one.
| Compound Name | (1E,4E)-1-[2-fluoro-5-(trifluoromethyl)phenyl]-5-(2,6,6-trimethylcyclohex-2-en-1-yl)penta-1,4-dien-3-one |
|---|---|
| PubChem CID | 44591411 |
| Molecular Formula | C21H22F4O |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | (1E,4E)-1-[2-fluoro-5-(trifluoromethyl)phenyl]-5-(2,6,6-trimethylcyclohex-2-en-1-yl)penta-1,4-dien-3-one |
| SMILES | CC1=CCCC(C)(C)C1/C=C/C(=O)/C=C/c1cc(C(F)(F)F)ccc1F |
| InChI | InChI=1S/C21H22F4O/c1-14-5-4-12-20(2,3)18(14)10-9-17(26)8-6-15-13-16(21(23,24)25)7-11-19(15)22/h5-11,13,18H,4,12H2,1-3H3/b8-6+,10-9+ |
| InChIKey | VXOCWXYAIIJLMS-QGHYKFKQSA-N |
| XLogP | 6.37 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|