C20H24O2 — CID 44591413
(1E,4E)-1-(3-hydroxy-2,6,6-trimethylcyclohexen-1-yl)-5-phenylpenta-1,4-dien-3-one (PubChem CID 44591413) has the molecular formula C20H24O2 and a molecular weight of 296.41 g/mol. Its IUPAC name is (1E,4E)-1-(3-hydroxy-2,6,6-trimethylcyclohexen-1-yl)-5-phenylpenta-1,4-dien-3-one.
| Compound Name | (1E,4E)-1-(3-hydroxy-2,6,6-trimethylcyclohexen-1-yl)-5-phenylpenta-1,4-dien-3-one |
|---|---|
| PubChem CID | 44591413 |
| Molecular Formula | C20H24O2 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | (1E,4E)-1-(3-hydroxy-2,6,6-trimethylcyclohexen-1-yl)-5-phenylpenta-1,4-dien-3-one |
| SMILES | CC1=C(/C=C/C(=O)/C=C/c2ccccc2)C(C)(C)CCC1O |
| InChI | InChI=1S/C20H24O2/c1-15-18(20(2,3)14-13-19(15)22)12-11-17(21)10-9-16-7-5-4-6-8-16/h4-12,19,22H,13-14H2,1-3H3/b10-9+,12-11+ |
| InChIKey | HMVINVTZNAEGTP-HULFFUFUSA-N |
| XLogP | 4.32 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|