C22H22F6O2 — CID 44591449
(1E,4E)-1-[3,5-bis(trifluoromethyl)phenyl]-5-(3-hydroxy-2,6,6-trimethylcyclohexen-1-yl)penta-1,4-dien-3-one (PubChem CID 44591449) has the molecular formula C22H22F6O2 and a molecular weight of 432.40 g/mol. Its IUPAC name is (1E,4E)-1-[3,5-bis(trifluoromethyl)phenyl]-5-(3-hydroxy-2,6,6-trimethylcyclohexen-1-yl)penta-1,4-dien-3-one.
| Compound Name | (1E,4E)-1-[3,5-bis(trifluoromethyl)phenyl]-5-(3-hydroxy-2,6,6-trimethylcyclohexen-1-yl)penta-1,4-dien-3-one |
|---|---|
| PubChem CID | 44591449 |
| Molecular Formula | C22H22F6O2 |
| Molecular Weight | 432.40 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | (1E,4E)-1-[3,5-bis(trifluoromethyl)phenyl]-5-(3-hydroxy-2,6,6-trimethylcyclohexen-1-yl)penta-1,4-dien-3-one |
| SMILES | CC1=C(/C=C/C(=O)/C=C/c2cc(C(F)(F)F)cc(C(F)(F)F)c2)C(C)(C)CCC1O |
| InChI | InChI=1S/C22H22F6O2/c1-13-18(20(2,3)9-8-19(13)30)7-6-17(29)5-4-14-10-15(21(23,24)25)12-16(11-14)22(26,27)28/h4-7,10-12,19,30H,8-9H2,1-3H3/b5-4+,7-6+ |
| InChIKey | TVYJUATUYSOJRR-YTXTXJHMSA-N |
| XLogP | 6.36 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.40 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|