About N-[2-(1H-imidazo[4,5-b]pyridin-2-yl)phenyl]-4-morpholin-4-ylbenzamide
N-[2-(1H-imidazo[4,5-b]pyridin-2-yl)phenyl]-4-morpholin-4-ylbenzamide (PubChem CID 44591557) has the molecular formula C23H21N5O2
and a molecular weight of 399.45 g/mol. Its IUPAC name is N-[2-(1H-imidazo[4,5-b]pyridin-2-yl)phenyl]-4-morpholin-4-ylbenzamide.
Molecular Properties
| Compound Name | N-[2-(1H-imidazo[4,5-b]pyridin-2-yl)phenyl]-4-morpholin-4-ylbenzamide |
| PubChem CID | 44591557 |
| Molecular Formula | C23H21N5O2 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | N-[2-(1H-imidazo[4,5-b]pyridin-2-yl)phenyl]-4-morpholin-4-ylbenzamide |
| SMILES | O=C(Nc1ccccc1-c1nc2ncccc2[nH]1)c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C23H21N5O2/c29-23(16-7-9-17(10-8-16)28-12-14-30-15-13-28)26-19-5-2-1-4-18(19)21-25-20-6-3-11-24-22(20)27-21/h1-11H,12-15H2,(H,26,29)(H,24,25,27) |
| InChIKey | KXCBHWKUBDQTFV-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[2-(1H-imidazo[4,5-b]pyridin-2-yl)phenyl]-4-morpholin-4-ylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(1H-imidazo[4,5-b]pyridin-2-yl)phenyl]-4-morpholin-4-ylbenzamide?
The IUPAC name of N-[2-(1H-imidazo[4,5-b]pyridin-2-yl)phenyl]-4-morpholin-4-ylbenzamide (CID 44591557) is N-[2-(1H-imidazo[4,5-b]pyridin-2-yl)phenyl]-4-morpholin-4-ylbenzamide.
What is the SMILES notation for N-[2-(1H-imidazo[4,5-b]pyridin-2-yl)phenyl]-4-morpholin-4-ylbenzamide?
The canonical SMILES for N-[2-(1H-imidazo[4,5-b]pyridin-2-yl)phenyl]-4-morpholin-4-ylbenzamide is O=C(Nc1ccccc1-c1nc2ncccc2[nH]1)c1ccc(N2CCOCC2)cc1.
What is the InChIKey of N-[2-(1H-imidazo[4,5-b]pyridin-2-yl)phenyl]-4-morpholin-4-ylbenzamide?
The InChIKey is KXCBHWKUBDQTFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21N5O2/c29-23(16-7-9-17(10-8-16)28-12-14-30-15-13-28)26-19-5-2-1-4-18(19)21-25-20-6-3-11-24-22(20)27-21/h1-11H,12-15H2,(H,26,29)(H,24,25,27).
What are the key properties of N-[2-(1H-imidazo[4,5-b]pyridin-2-yl)phenyl]-4-morpholin-4-ylbenzamide?
N-[2-(1H-imidazo[4,5-b]pyridin-2-yl)phenyl]-4-morpholin-4-ylbenzamide has a molecular weight of 399.45 g/mol, XLogP of 3.71, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(1H-imidazo[4,5-b]pyridin-2-yl)phenyl]-4-morpholin-4-ylbenzamide is sourced from PubChem (CID 44591557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).