C24H25Cl2N5O — CID 44591596
1-[(2,4-dichlorophenyl)methyl]-N-(1-methyl-4,5-dihydro-[1,2,4]triazolo[4,3-a]quinolin-7-yl)piperidine-4-carboxamide (PubChem CID 44591596) has the molecular formula C24H25Cl2N5O and a molecular weight of 470.40 g/mol. Its IUPAC name is 1-[(2,4-dichlorophenyl)methyl]-N-(1-methyl-4,5-dihydro-[1,2,4]triazolo[4,3-a]quinolin-7-yl)piperidine-4-carboxamide.
| Compound Name | 1-[(2,4-dichlorophenyl)methyl]-N-(1-methyl-4,5-dihydro-[1,2,4]triazolo[4,3-a]quinolin-7-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 44591596 |
| Molecular Formula | C24H25Cl2N5O |
| Molecular Weight | 470.40 g/mol |
| Exact Mass | 469.14 |
| IUPAC Name | 1-[(2,4-dichlorophenyl)methyl]-N-(1-methyl-4,5-dihydro-[1,2,4]triazolo[4,3-a]quinolin-7-yl)piperidine-4-carboxamide |
| SMILES | Cc1nnc2n1-c1ccc(NC(=O)C3CCN(Cc4ccc(Cl)cc4Cl)CC3)cc1CC2 |
| InChI | InChI=1S/C24H25Cl2N5O/c1-15-28-29-23-7-3-17-12-20(5-6-22(17)31(15)23)27-24(32)16-8-10-30(11-9-16)14-18-2-4-19(25)13-21(18)26/h2,4-6,12-13,16H,3,7-11,14H2,1H3,(H,27,32) |
| InChIKey | DSMCSCYLHZAVHD-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.40 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |