C24H22N2O2 — CID 44591644
ethyl (4R,5R)-2,4,5-triphenyl-1,4-dihydroimidazole-5-carboxylate (PubChem CID 44591644) has the molecular formula C24H22N2O2 and a molecular weight of 370.45 g/mol. Its IUPAC name is ethyl (4R,5R)-2,4,5-triphenyl-1,4-dihydroimidazole-5-carboxylate.
| Compound Name | ethyl (4R,5R)-2,4,5-triphenyl-1,4-dihydroimidazole-5-carboxylate |
|---|---|
| PubChem CID | 44591644 |
| Molecular Formula | C24H22N2O2 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | ethyl (4R,5R)-2,4,5-triphenyl-1,4-dihydroimidazole-5-carboxylate |
| SMILES | CCOC(=O)[C@]1(c2ccccc2)NC(c2ccccc2)=N[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C24H22N2O2/c1-2-28-23(27)24(20-16-10-5-11-17-20)21(18-12-6-3-7-13-18)25-22(26-24)19-14-8-4-9-15-19/h3-17,21H,2H2,1H3,(H,25,26)/t21-,24-/m1/s1 |
| InChIKey | WLYVMMJBNLMSEI-ZJSXRUAMSA-N |
| XLogP | 4.24 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |