About 2-amino-4,5-bis(4-methoxyphenyl)-6-methylsulfanylbenzene-1,3-dicarbonitrile
2-amino-4,5-bis(4-methoxyphenyl)-6-methylsulfanylbenzene-1,3-dicarbonitrile (PubChem CID 44591657) has the molecular formula C23H19N3O2S
and a molecular weight of 401.49 g/mol. Its IUPAC name is 2-amino-4,5-bis(4-methoxyphenyl)-6-methylsulfanylbenzene-1,3-dicarbonitrile.
Molecular Properties
| Compound Name | 2-amino-4,5-bis(4-methoxyphenyl)-6-methylsulfanylbenzene-1,3-dicarbonitrile |
| PubChem CID | 44591657 |
| Molecular Formula | C23H19N3O2S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | 2-amino-4,5-bis(4-methoxyphenyl)-6-methylsulfanylbenzene-1,3-dicarbonitrile |
| SMILES | COc1ccc(-c2c(C#N)c(N)c(C#N)c(SC)c2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C23H19N3O2S/c1-27-16-8-4-14(5-9-16)20-18(12-24)22(26)19(13-25)23(29-3)21(20)15-6-10-17(28-2)11-7-15/h4-11H,26H2,1-3H3 |
| InChIKey | AMBKYDPIBLVIEK-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 92.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-4,5-bis(4-methoxyphenyl)-6-methylsulfanylbenzene-1,3-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4,5-bis(4-methoxyphenyl)-6-methylsulfanylbenzene-1,3-dicarbonitrile?
The IUPAC name of 2-amino-4,5-bis(4-methoxyphenyl)-6-methylsulfanylbenzene-1,3-dicarbonitrile (CID 44591657) is 2-amino-4,5-bis(4-methoxyphenyl)-6-methylsulfanylbenzene-1,3-dicarbonitrile.
What is the SMILES notation for 2-amino-4,5-bis(4-methoxyphenyl)-6-methylsulfanylbenzene-1,3-dicarbonitrile?
The canonical SMILES for 2-amino-4,5-bis(4-methoxyphenyl)-6-methylsulfanylbenzene-1,3-dicarbonitrile is COc1ccc(-c2c(C#N)c(N)c(C#N)c(SC)c2-c2ccc(OC)cc2)cc1.
What is the InChIKey of 2-amino-4,5-bis(4-methoxyphenyl)-6-methylsulfanylbenzene-1,3-dicarbonitrile?
The InChIKey is AMBKYDPIBLVIEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H19N3O2S/c1-27-16-8-4-14(5-9-16)20-18(12-24)22(26)19(13-25)23(29-3)21(20)15-6-10-17(28-2)11-7-15/h4-11H,26H2,1-3H3.
What are the key properties of 2-amino-4,5-bis(4-methoxyphenyl)-6-methylsulfanylbenzene-1,3-dicarbonitrile?
2-amino-4,5-bis(4-methoxyphenyl)-6-methylsulfanylbenzene-1,3-dicarbonitrile has a molecular weight of 401.49 g/mol, XLogP of 5.09, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4,5-bis(4-methoxyphenyl)-6-methylsulfanylbenzene-1,3-dicarbonitrile is sourced from PubChem (CID 44591657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).