C20H17NO — CID 44591786
(13S,15S)-15-phenyl-16-oxa-1-azatetracyclo[11.2.1.02,11.03,8]hexadeca-2(11),3,5,7,9-pentaene (PubChem CID 44591786) has the molecular formula C20H17NO and a molecular weight of 287.36 g/mol. Its IUPAC name is (13S,15S)-15-phenyl-16-oxa-1-azatetracyclo[11.2.1.02,11.03,8]hexadeca-2(11),3,5,7,9-pentaene.
| Compound Name | (13S,15S)-15-phenyl-16-oxa-1-azatetracyclo[11.2.1.02,11.03,8]hexadeca-2(11),3,5,7,9-pentaene |
|---|---|
| PubChem CID | 44591786 |
| Molecular Formula | C20H17NO |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | (13S,15S)-15-phenyl-16-oxa-1-azatetracyclo[11.2.1.02,11.03,8]hexadeca-2(11),3,5,7,9-pentaene |
| SMILES | c1ccc([C@@H]2C[C@@H]3Cc4ccc5ccccc5c4N2O3)cc1 |
| InChI | InChI=1S/C20H17NO/c1-2-7-15(8-3-1)19-13-17-12-16-11-10-14-6-4-5-9-18(14)20(16)21(19)22-17/h1-11,17,19H,12-13H2/t17-,19-/m0/s1 |
| InChIKey | GITZZMVIOAVVDW-HKUYNNGSSA-N |
| XLogP | 4.65 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |