C20H23F3N4O — CID 44591848
[4-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]piperidin-1-yl]-(2,5-dimethylpyrimidin-4-yl)methanone (PubChem CID 44591848) has the molecular formula C20H23F3N4O and a molecular weight of 392.43 g/mol. Its IUPAC name is [4-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]piperidin-1-yl]-(2,5-dimethylpyrimidin-4-yl)methanone.
| Compound Name | [4-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]piperidin-1-yl]-(2,5-dimethylpyrimidin-4-yl)methanone |
|---|---|
| PubChem CID | 44591848 |
| Molecular Formula | C20H23F3N4O |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | [4-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]piperidin-1-yl]-(2,5-dimethylpyrimidin-4-yl)methanone |
| SMILES | Cc1ncc(C)c(C(=O)N2CCC([C@H](N)Cc3cc(F)c(F)cc3F)CC2)n1 |
| InChI | InChI=1S/C20H23F3N4O/c1-11-10-25-12(2)26-19(11)20(28)27-5-3-13(4-6-27)18(24)8-14-7-16(22)17(23)9-15(14)21/h7,9-10,13,18H,3-6,8,24H2,1-2H3/t18-/m1/s1 |
| InChIKey | AOIBZBXINYLQJL-GOSISDBHSA-N |
| XLogP | 2.93 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|