C20H20F3N5O — CID 44591850
[4-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]piperidin-1-yl]-imidazo[1,2-a]pyrimidin-3-ylmethanone (PubChem CID 44591850) has the molecular formula C20H20F3N5O and a molecular weight of 403.41 g/mol. Its IUPAC name is [4-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]piperidin-1-yl]-imidazo[1,2-a]pyrimidin-3-ylmethanone.
| Compound Name | [4-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]piperidin-1-yl]-imidazo[1,2-a]pyrimidin-3-ylmethanone |
|---|---|
| PubChem CID | 44591850 |
| Molecular Formula | C20H20F3N5O |
| Molecular Weight | 403.41 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | [4-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]piperidin-1-yl]-imidazo[1,2-a]pyrimidin-3-ylmethanone |
| SMILES | N[C@H](Cc1cc(F)c(F)cc1F)C1CCN(C(=O)c2cnc3ncccn23)CC1 |
| InChI | InChI=1S/C20H20F3N5O/c21-14-10-16(23)15(22)8-13(14)9-17(24)12-2-6-27(7-3-12)19(29)18-11-26-20-25-4-1-5-28(18)20/h1,4-5,8,10-12,17H,2-3,6-7,9,24H2/t17-/m1/s1 |
| InChIKey | DOHKHSZNXWSFJH-QGZVFWFLSA-N |
| XLogP | 2.57 |
| TPSA | 76.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.41 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|