C24H39N3 — CID 44591886
1-[[4-(dimethylamino)phenyl]methyl]-N-[(1R,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]piperidin-4-amine (PubChem CID 44591886) has the molecular formula C24H39N3 and a molecular weight of 369.60 g/mol. Its IUPAC name is 1-[[4-(dimethylamino)phenyl]methyl]-N-[(1R,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]piperidin-4-amine.
| Compound Name | 1-[[4-(dimethylamino)phenyl]methyl]-N-[(1R,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]piperidin-4-amine |
|---|---|
| PubChem CID | 44591886 |
| Molecular Formula | C24H39N3 |
| Molecular Weight | 369.60 g/mol |
| Exact Mass | 369.31 |
| IUPAC Name | 1-[[4-(dimethylamino)phenyl]methyl]-N-[(1R,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]piperidin-4-amine |
| SMILES | CN(C)c1ccc(CN2CCC(N[C@@H]3C[C@H]4CC[C@]3(C)C4(C)C)CC2)cc1 |
| InChI | InChI=1S/C24H39N3/c1-23(2)19-10-13-24(23,3)22(16-19)25-20-11-14-27(15-12-20)17-18-6-8-21(9-7-18)26(4)5/h6-9,19-20,22,25H,10-17H2,1-5H3/t19-,22-,24+/m1/s1 |
| InChIKey | YIPNKKSJZLSJCZ-CKUXNOBLSA-N |
| XLogP | 4.52 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.60 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|