C16H23N5O — CID 44592031
4-N-cyclohexyl-6-N-(2-methoxyethyl)pyrido[3,4-d]pyrimidine-4,6-diamine (PubChem CID 44592031) has the molecular formula C16H23N5O and a molecular weight of 301.39 g/mol. Its IUPAC name is 4-N-cyclohexyl-6-N-(2-methoxyethyl)pyrido[3,4-d]pyrimidine-4,6-diamine.
| Compound Name | 4-N-cyclohexyl-6-N-(2-methoxyethyl)pyrido[3,4-d]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 44592031 |
| Molecular Formula | C16H23N5O |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.19 |
| IUPAC Name | 4-N-cyclohexyl-6-N-(2-methoxyethyl)pyrido[3,4-d]pyrimidine-4,6-diamine |
| SMILES | COCCNc1cc2c(NC3CCCCC3)ncnc2cn1 |
| InChI | InChI=1S/C16H23N5O/c1-22-8-7-17-15-9-13-14(10-18-15)19-11-20-16(13)21-12-5-3-2-4-6-12/h9-12H,2-8H2,1H3,(H,17,18)(H,19,20,21) |
| InChIKey | CWBRSHBXLYLKEG-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 71.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|