C20H24FN3O3 — CID 44592173
ethyl 2-[(4-fluoro-2-methylanilino)methyl]-6-morpholin-4-ylpyridine-4-carboxylate (PubChem CID 44592173) has the molecular formula C20H24FN3O3 and a molecular weight of 373.43 g/mol. Its IUPAC name is ethyl 2-[(4-fluoro-2-methylanilino)methyl]-6-morpholin-4-ylpyridine-4-carboxylate.
| Compound Name | ethyl 2-[(4-fluoro-2-methylanilino)methyl]-6-morpholin-4-ylpyridine-4-carboxylate |
|---|---|
| PubChem CID | 44592173 |
| Molecular Formula | C20H24FN3O3 |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | ethyl 2-[(4-fluoro-2-methylanilino)methyl]-6-morpholin-4-ylpyridine-4-carboxylate |
| SMILES | CCOC(=O)c1cc(CNc2ccc(F)cc2C)nc(N2CCOCC2)c1 |
| InChI | InChI=1S/C20H24FN3O3/c1-3-27-20(25)15-11-17(13-22-18-5-4-16(21)10-14(18)2)23-19(12-15)24-6-8-26-9-7-24/h4-5,10-12,22H,3,6-9,13H2,1-2H3 |
| InChIKey | NZTCAAOXNBKKDC-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |