C15H27NO — CID 44592231
N,N,3-triethyl-2-oxatricyclo[3.3.1.13,7]decan-1-amine (PubChem CID 44592231) has the molecular formula C15H27NO and a molecular weight of 237.39 g/mol. Its IUPAC name is N,N,3-triethyl-2-oxatricyclo[3.3.1.13,7]decan-1-amine.
| Compound Name | N,N,3-triethyl-2-oxatricyclo[3.3.1.13,7]decan-1-amine |
|---|---|
| PubChem CID | 44592231 |
| Molecular Formula | C15H27NO |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.21 |
| IUPAC Name | N,N,3-triethyl-2-oxatricyclo[3.3.1.13,7]decan-1-amine |
| SMILES | CCN(CC)C12CC3CC(CC(CC)(C3)O1)C2 |
| InChI | InChI=1S/C15H27NO/c1-4-14-8-12-7-13(9-14)11-15(10-12,17-14)16(5-2)6-3/h12-13H,4-11H2,1-3H3 |
| InChIKey | KGDKJEMGFLSUBU-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |