C12H12N2O2S2 — CID 44592347
[(2S,5R)-5-(4-methylsulfanylthieno[3,4-d]pyrimidin-7-yl)-2,5-dihydrofuran-2-yl]methanol (PubChem CID 44592347) has the molecular formula C12H12N2O2S2 and a molecular weight of 280.37 g/mol. Its IUPAC name is [(2S,5R)-5-(4-methylsulfanylthieno[3,4-d]pyrimidin-7-yl)-2,5-dihydrofuran-2-yl]methanol.
| Compound Name | [(2S,5R)-5-(4-methylsulfanylthieno[3,4-d]pyrimidin-7-yl)-2,5-dihydrofuran-2-yl]methanol |
|---|---|
| PubChem CID | 44592347 |
| Molecular Formula | C12H12N2O2S2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | [(2S,5R)-5-(4-methylsulfanylthieno[3,4-d]pyrimidin-7-yl)-2,5-dihydrofuran-2-yl]methanol |
| SMILES | CSc1ncnc2c([C@H]3C=C[C@@H](CO)O3)scc12 |
| InChI | InChI=1S/C12H12N2O2S2/c1-17-12-8-5-18-11(10(8)13-6-14-12)9-3-2-7(4-15)16-9/h2-3,5-7,9,15H,4H2,1H3/t7-,9+/m0/s1 |
| InChIKey | WDEWFNILYBZLOH-IONNQARKSA-N |
| XLogP | 2.40 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|