C11H11N3O2S — CID 44592348
[(2S,5R)-5-(4-aminothieno[3,4-d]pyrimidin-7-yl)-2,5-dihydrofuran-2-yl]methanol (PubChem CID 44592348) has the molecular formula C11H11N3O2S and a molecular weight of 249.30 g/mol. Its IUPAC name is [(2S,5R)-5-(4-aminothieno[3,4-d]pyrimidin-7-yl)-2,5-dihydrofuran-2-yl]methanol.
| Compound Name | [(2S,5R)-5-(4-aminothieno[3,4-d]pyrimidin-7-yl)-2,5-dihydrofuran-2-yl]methanol |
|---|---|
| PubChem CID | 44592348 |
| Molecular Formula | C11H11N3O2S |
| Molecular Weight | 249.30 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | [(2S,5R)-5-(4-aminothieno[3,4-d]pyrimidin-7-yl)-2,5-dihydrofuran-2-yl]methanol |
| SMILES | Nc1ncnc2c([C@H]3C=C[C@@H](CO)O3)scc12 |
| InChI | InChI=1S/C11H11N3O2S/c12-11-7-4-17-10(9(7)13-5-14-11)8-2-1-6(3-15)16-8/h1-2,4-6,8,15H,3H2,(H2,12,13,14)/t6-,8+/m0/s1 |
| InChIKey | BDMFZQQKZAOZJV-POYBYMJQSA-N |
| XLogP | 1.26 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.30 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|