About 2-bromo-N-[4-[(E)-3-(2,4-dimethoxyphenyl)prop-2-enoyl]phenyl]prop-2-enamide
2-bromo-N-[4-[(E)-3-(2,4-dimethoxyphenyl)prop-2-enoyl]phenyl]prop-2-enamide (PubChem CID 44592479) has the molecular formula C20H18BrNO4
and a molecular weight of 416.27 g/mol. Its IUPAC name is 2-bromo-N-[4-[(E)-3-(2,4-dimethoxyphenyl)prop-2-enoyl]phenyl]prop-2-enamide.
Molecular Properties
| Compound Name | 2-bromo-N-[4-[(E)-3-(2,4-dimethoxyphenyl)prop-2-enoyl]phenyl]prop-2-enamide |
| PubChem CID | 44592479 |
| Molecular Formula | C20H18BrNO4 |
| Molecular Weight | 416.27 g/mol |
| Exact Mass | 415.04 |
| IUPAC Name | 2-bromo-N-[4-[(E)-3-(2,4-dimethoxyphenyl)prop-2-enoyl]phenyl]prop-2-enamide |
| SMILES | C=C(Br)C(=O)Nc1ccc(C(=O)/C=C/c2ccc(OC)cc2OC)cc1 |
| InChI | InChI=1S/C20H18BrNO4/c1-13(21)20(24)22-16-8-4-14(5-9-16)18(23)11-7-15-6-10-17(25-2)12-19(15)26-3/h4-12H,1H2,2-3H3,(H,22,24)/b11-7+ |
| InChIKey | WTXWUDFWVHBZGA-YRNVUSSQSA-N |
| XLogP | 4.45 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.27 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-N-[4-[(E)-3-(2,4-dimethoxyphenyl)prop-2-enoyl]phenyl]prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-N-[4-[(E)-3-(2,4-dimethoxyphenyl)prop-2-enoyl]phenyl]prop-2-enamide?
The IUPAC name of 2-bromo-N-[4-[(E)-3-(2,4-dimethoxyphenyl)prop-2-enoyl]phenyl]prop-2-enamide (CID 44592479) is 2-bromo-N-[4-[(E)-3-(2,4-dimethoxyphenyl)prop-2-enoyl]phenyl]prop-2-enamide.
What is the SMILES notation for 2-bromo-N-[4-[(E)-3-(2,4-dimethoxyphenyl)prop-2-enoyl]phenyl]prop-2-enamide?
The canonical SMILES for 2-bromo-N-[4-[(E)-3-(2,4-dimethoxyphenyl)prop-2-enoyl]phenyl]prop-2-enamide is C=C(Br)C(=O)Nc1ccc(C(=O)/C=C/c2ccc(OC)cc2OC)cc1.
What is the InChIKey of 2-bromo-N-[4-[(E)-3-(2,4-dimethoxyphenyl)prop-2-enoyl]phenyl]prop-2-enamide?
The InChIKey is WTXWUDFWVHBZGA-YRNVUSSQSA-N. The full InChI is InChI=1S/C20H18BrNO4/c1-13(21)20(24)22-16-8-4-14(5-9-16)18(23)11-7-15-6-10-17(25-2)12-19(15)26-3/h4-12H,1H2,2-3H3,(H,22,24)/b11-7+.
What are the key properties of 2-bromo-N-[4-[(E)-3-(2,4-dimethoxyphenyl)prop-2-enoyl]phenyl]prop-2-enamide?
2-bromo-N-[4-[(E)-3-(2,4-dimethoxyphenyl)prop-2-enoyl]phenyl]prop-2-enamide has a molecular weight of 416.27 g/mol, XLogP of 4.45, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-N-[4-[(E)-3-(2,4-dimethoxyphenyl)prop-2-enoyl]phenyl]prop-2-enamide is sourced from PubChem (CID 44592479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).