C13H17F3N2 — CID 44592507
(1R)-1-piperidin-4-yl-2-(2,4,5-trifluorophenyl)ethanamine (PubChem CID 44592507) has the molecular formula C13H17F3N2 and a molecular weight of 258.29 g/mol. Its IUPAC name is (1R)-1-piperidin-4-yl-2-(2,4,5-trifluorophenyl)ethanamine.
| Compound Name | (1R)-1-piperidin-4-yl-2-(2,4,5-trifluorophenyl)ethanamine |
|---|---|
| PubChem CID | 44592507 |
| Molecular Formula | C13H17F3N2 |
| Molecular Weight | 258.29 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | (1R)-1-piperidin-4-yl-2-(2,4,5-trifluorophenyl)ethanamine |
| SMILES | N[C@H](Cc1cc(F)c(F)cc1F)C1CCNCC1 |
| InChI | InChI=1S/C13H17F3N2/c14-10-7-12(16)11(15)5-9(10)6-13(17)8-1-3-18-4-2-8/h5,7-8,13,18H,1-4,6,17H2/t13-/m1/s1 |
| InChIKey | MQSDKIHWNPNOSU-CYBMUJFWSA-N |
| XLogP | 1.97 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.29 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|