C22H32F2N2 — CID 44592531
1-[(2,4-difluorophenyl)methyl]-N-[(1R,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]piperidin-4-amine (PubChem CID 44592531) has the molecular formula C22H32F2N2 and a molecular weight of 362.51 g/mol. Its IUPAC name is 1-[(2,4-difluorophenyl)methyl]-N-[(1R,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]piperidin-4-amine.
| Compound Name | 1-[(2,4-difluorophenyl)methyl]-N-[(1R,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]piperidin-4-amine |
|---|---|
| PubChem CID | 44592531 |
| Molecular Formula | C22H32F2N2 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | 1-[(2,4-difluorophenyl)methyl]-N-[(1R,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]piperidin-4-amine |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)[C@H](NC1CCN(Cc3ccc(F)cc3F)CC1)C2 |
| InChI | InChI=1S/C22H32F2N2/c1-21(2)16-6-9-22(21,3)20(12-16)25-18-7-10-26(11-8-18)14-15-4-5-17(23)13-19(15)24/h4-5,13,16,18,20,25H,6-12,14H2,1-3H3/t16-,20-,22+/m1/s1 |
| InChIKey | VCOOTZBAKHCZJY-CNDZOEFASA-N |
| XLogP | 4.73 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |