C22H27NO3S — CID 44592614
methyl 4-[(E,1R)-2-propyl-1-(thiophene-2-carbonylamino)hex-2-enyl]benzoate (PubChem CID 44592614) has the molecular formula C22H27NO3S and a molecular weight of 385.53 g/mol. Its IUPAC name is methyl 4-[(E,1R)-2-propyl-1-(thiophene-2-carbonylamino)hex-2-enyl]benzoate.
| Compound Name | methyl 4-[(E,1R)-2-propyl-1-(thiophene-2-carbonylamino)hex-2-enyl]benzoate |
|---|---|
| PubChem CID | 44592614 |
| Molecular Formula | C22H27NO3S |
| Molecular Weight | 385.53 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | methyl 4-[(E,1R)-2-propyl-1-(thiophene-2-carbonylamino)hex-2-enyl]benzoate |
| SMILES | CCC/C=C(\CCC)[C@@H](NC(=O)c1cccs1)c1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C22H27NO3S/c1-4-6-9-16(8-5-2)20(23-21(24)19-10-7-15-27-19)17-11-13-18(14-12-17)22(25)26-3/h7,9-15,20H,4-6,8H2,1-3H3,(H,23,24)/b16-9+/t20-/m1/s1 |
| InChIKey | IXZLTVDWCKVCQI-RIMDVYMRSA-N |
| XLogP | 5.53 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.53 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|