C22H33NO3 — CID 44592657
methyl 4-[(E,1R)-1-(2,2-dimethylpropanoylamino)-2-propylhex-2-enyl]benzoate (PubChem CID 44592657) has the molecular formula C22H33NO3 and a molecular weight of 359.51 g/mol. Its IUPAC name is methyl 4-[(E,1R)-1-(2,2-dimethylpropanoylamino)-2-propylhex-2-enyl]benzoate.
| Compound Name | methyl 4-[(E,1R)-1-(2,2-dimethylpropanoylamino)-2-propylhex-2-enyl]benzoate |
|---|---|
| PubChem CID | 44592657 |
| Molecular Formula | C22H33NO3 |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.25 |
| IUPAC Name | methyl 4-[(E,1R)-1-(2,2-dimethylpropanoylamino)-2-propylhex-2-enyl]benzoate |
| SMILES | CCC/C=C(\CCC)[C@@H](NC(=O)C(C)(C)C)c1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C22H33NO3/c1-7-9-11-16(10-8-2)19(23-21(25)22(3,4)5)17-12-14-18(15-13-17)20(24)26-6/h11-15,19H,7-10H2,1-6H3,(H,23,25)/b16-11+/t19-/m1/s1 |
| InChIKey | RMLWMIFCPNWELL-KZIRBZLESA-N |
| XLogP | 5.20 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|