About 6-[[(2R,3S)-2-amino-3-hydroxy-3-(4-nitrophenyl)propanoyl]amino]hexanoic acid
6-[[(2R,3S)-2-amino-3-hydroxy-3-(4-nitrophenyl)propanoyl]amino]hexanoic acid (PubChem CID 44592697) has the molecular formula C15H21N3O6
and a molecular weight of 339.35 g/mol. Its IUPAC name is 6-[[(2R,3S)-2-amino-3-hydroxy-3-(4-nitrophenyl)propanoyl]amino]hexanoic acid.
Molecular Properties
| Compound Name | 6-[[(2R,3S)-2-amino-3-hydroxy-3-(4-nitrophenyl)propanoyl]amino]hexanoic acid |
| PubChem CID | 44592697 |
| Molecular Formula | C15H21N3O6 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | 6-[[(2R,3S)-2-amino-3-hydroxy-3-(4-nitrophenyl)propanoyl]amino]hexanoic acid |
| SMILES | N[C@@H](C(=O)NCCCCCC(=O)O)[C@@H](O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H21N3O6/c16-13(15(22)17-9-3-1-2-4-12(19)20)14(21)10-5-7-11(8-6-10)18(23)24/h5-8,13-14,21H,1-4,9,16H2,(H,17,22)(H,19,20)/t13-,14+/m1/s1 |
| InChIKey | SARUKRLNZDWYGW-KGLIPLIRSA-N |
| XLogP | 0.72 |
| TPSA | 155.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-[[(2R,3S)-2-amino-3-hydroxy-3-(4-nitrophenyl)propanoyl]amino]hexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[[(2R,3S)-2-amino-3-hydroxy-3-(4-nitrophenyl)propanoyl]amino]hexanoic acid?
The IUPAC name of 6-[[(2R,3S)-2-amino-3-hydroxy-3-(4-nitrophenyl)propanoyl]amino]hexanoic acid (CID 44592697) is 6-[[(2R,3S)-2-amino-3-hydroxy-3-(4-nitrophenyl)propanoyl]amino]hexanoic acid.
What is the SMILES notation for 6-[[(2R,3S)-2-amino-3-hydroxy-3-(4-nitrophenyl)propanoyl]amino]hexanoic acid?
The canonical SMILES for 6-[[(2R,3S)-2-amino-3-hydroxy-3-(4-nitrophenyl)propanoyl]amino]hexanoic acid is N[C@@H](C(=O)NCCCCCC(=O)O)[C@@H](O)c1ccc([N+](=O)[O-])cc1.
What is the InChIKey of 6-[[(2R,3S)-2-amino-3-hydroxy-3-(4-nitrophenyl)propanoyl]amino]hexanoic acid?
The InChIKey is SARUKRLNZDWYGW-KGLIPLIRSA-N. The full InChI is InChI=1S/C15H21N3O6/c16-13(15(22)17-9-3-1-2-4-12(19)20)14(21)10-5-7-11(8-6-10)18(23)24/h5-8,13-14,21H,1-4,9,16H2,(H,17,22)(H,19,20)/t13-,14+/m1/s1.
What are the key properties of 6-[[(2R,3S)-2-amino-3-hydroxy-3-(4-nitrophenyl)propanoyl]amino]hexanoic acid?
6-[[(2R,3S)-2-amino-3-hydroxy-3-(4-nitrophenyl)propanoyl]amino]hexanoic acid has a molecular weight of 339.35 g/mol, XLogP of 0.72, 10 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[[(2R,3S)-2-amino-3-hydroxy-3-(4-nitrophenyl)propanoyl]amino]hexanoic acid is sourced from PubChem (CID 44592697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).