C21H37NO4 — CID 44592715
3-hydroxy-2-[[(6E,9E)-octadeca-6,9-dienoyl]amino]propanoic acid (PubChem CID 44592715) has the molecular formula C21H37NO4 and a molecular weight of 367.53 g/mol. Its IUPAC name is 3-hydroxy-2-[[(6E,9E)-octadeca-6,9-dienoyl]amino]propanoic acid.
| Compound Name | 3-hydroxy-2-[[(6E,9E)-octadeca-6,9-dienoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 44592715 |
| Molecular Formula | C21H37NO4 |
| Molecular Weight | 367.53 g/mol |
| Exact Mass | 367.27 |
| IUPAC Name | 3-hydroxy-2-[[(6E,9E)-octadeca-6,9-dienoyl]amino]propanoic acid |
| SMILES | CCCCCCCC/C=C/C/C=C/CCCCC(=O)NC(CO)C(=O)O |
| InChI | InChI=1S/C21H37NO4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(24)22-19(18-23)21(25)26/h9-10,12-13,19,23H,2-8,11,14-18H2,1H3,(H,22,24)(H,25,26)/b10-9+,13-12+ |
| InChIKey | BVQUNEXLCHZSHB-OKLKQMLOSA-N |
| XLogP | 4.36 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.53 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|