C18H20N4O6 — CID 44592735
(2R,3S)-2-amino-3-hydroxy-N-[(2S)-1-(hydroxyamino)-1-oxo-3-phenylpropan-2-yl]-3-(4-nitrophenyl)propanamide (PubChem CID 44592735) has the molecular formula C18H20N4O6 and a molecular weight of 388.38 g/mol. Its IUPAC name is (2R,3S)-2-amino-3-hydroxy-N-[(2S)-1-(hydroxyamino)-1-oxo-3-phenylpropan-2-yl]-3-(4-nitrophenyl)propanamide.
| Compound Name | (2R,3S)-2-amino-3-hydroxy-N-[(2S)-1-(hydroxyamino)-1-oxo-3-phenylpropan-2-yl]-3-(4-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 44592735 |
| Molecular Formula | C18H20N4O6 |
| Molecular Weight | 388.38 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | (2R,3S)-2-amino-3-hydroxy-N-[(2S)-1-(hydroxyamino)-1-oxo-3-phenylpropan-2-yl]-3-(4-nitrophenyl)propanamide |
| SMILES | N[C@@H](C(=O)N[C@@H](Cc1ccccc1)C(=O)NO)[C@@H](O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H20N4O6/c19-15(16(23)12-6-8-13(9-7-12)22(27)28)18(25)20-14(17(24)21-26)10-11-4-2-1-3-5-11/h1-9,14-16,23,26H,10,19H2,(H,20,25)(H,21,24)/t14-,15+,16-/m0/s1 |
| InChIKey | RWNRWRAUBGOASE-XHSDSOJGSA-N |
| XLogP | 0.19 |
| TPSA | 167.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.38 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|