C23H39NO4 — CID 44592750
ethyl 3-hydroxy-2-[[(3E,6E,9E)-octadeca-3,6,9-trienoyl]amino]propanoate (PubChem CID 44592750) has the molecular formula C23H39NO4 and a molecular weight of 393.57 g/mol. Its IUPAC name is ethyl 3-hydroxy-2-[[(3E,6E,9E)-octadeca-3,6,9-trienoyl]amino]propanoate.
| Compound Name | ethyl 3-hydroxy-2-[[(3E,6E,9E)-octadeca-3,6,9-trienoyl]amino]propanoate |
|---|---|
| PubChem CID | 44592750 |
| Molecular Formula | C23H39NO4 |
| Molecular Weight | 393.57 g/mol |
| Exact Mass | 393.29 |
| IUPAC Name | ethyl 3-hydroxy-2-[[(3E,6E,9E)-octadeca-3,6,9-trienoyl]amino]propanoate |
| SMILES | CCCCCCCC/C=C/C/C=C/C/C=C/CC(=O)NC(CO)C(=O)OCC |
| InChI | InChI=1S/C23H39NO4/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22(26)24-21(20-25)23(27)28-4-2/h11-12,14-15,17-18,21,25H,3-10,13,16,19-20H2,1-2H3,(H,24,26)/b12-11+,15-14+,18-17+ |
| InChIKey | AMEUXOJZDMTOFV-KIXMHYHYSA-N |
| XLogP | 4.62 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.57 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|