C23H37NO4 — CID 44592753
3-hydroxy-2-[[(6E,9E,12E,15E)-icosa-6,9,12,15-tetraenoyl]amino]propanoic acid (PubChem CID 44592753) has the molecular formula C23H37NO4 and a molecular weight of 391.55 g/mol. Its IUPAC name is 3-hydroxy-2-[[(6E,9E,12E,15E)-icosa-6,9,12,15-tetraenoyl]amino]propanoic acid.
| Compound Name | 3-hydroxy-2-[[(6E,9E,12E,15E)-icosa-6,9,12,15-tetraenoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 44592753 |
| Molecular Formula | C23H37NO4 |
| Molecular Weight | 391.55 g/mol |
| Exact Mass | 391.27 |
| IUPAC Name | 3-hydroxy-2-[[(6E,9E,12E,15E)-icosa-6,9,12,15-tetraenoyl]amino]propanoic acid |
| SMILES | CCCC/C=C/C/C=C/C/C=C/C/C=C/CCCCC(=O)NC(CO)C(=O)O |
| InChI | InChI=1S/C23H37NO4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22(26)24-21(20-25)23(27)28/h5-6,8-9,11-12,14-15,21,25H,2-4,7,10,13,16-20H2,1H3,(H,24,26)(H,27,28)/b6-5+,9-8+,12-11+,15-14+ |
| InChIKey | BKRDQIYHSUYVRL-SFYIKTPXSA-N |
| XLogP | 4.69 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.55 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|