About methyl 4-[(E,1R)-2-propyl-1-(quinolin-8-ylsulfonylamino)hex-2-enyl]benzoate
methyl 4-[(E,1R)-2-propyl-1-(quinolin-8-ylsulfonylamino)hex-2-enyl]benzoate (PubChem CID 44592764) has the molecular formula C26H30N2O4S
and a molecular weight of 466.60 g/mol. Its IUPAC name is methyl 4-[(E,1R)-2-propyl-1-(quinolin-8-ylsulfonylamino)hex-2-enyl]benzoate.
Molecular Properties
| Compound Name | methyl 4-[(E,1R)-2-propyl-1-(quinolin-8-ylsulfonylamino)hex-2-enyl]benzoate |
| PubChem CID | 44592764 |
| Molecular Formula | C26H30N2O4S |
| Molecular Weight | 466.60 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | methyl 4-[(E,1R)-2-propyl-1-(quinolin-8-ylsulfonylamino)hex-2-enyl]benzoate |
| SMILES | CCC/C=C(\CCC)[C@@H](NS(=O)(=O)c1cccc2cccnc12)c1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C26H30N2O4S/c1-4-6-10-19(9-5-2)24(21-14-16-22(17-15-21)26(29)32-3)28-33(30,31)23-13-7-11-20-12-8-18-27-25(20)23/h7-8,10-18,24,28H,4-6,9H2,1-3H3/b19-10+/t24-/m1/s1 |
| InChIKey | RQLDSLDAEIFKJV-PEHFAQBGSA-N |
| XLogP | 5.57 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 466.60 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-[(E,1R)-2-propyl-1-(quinolin-8-ylsulfonylamino)hex-2-enyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[(E,1R)-2-propyl-1-(quinolin-8-ylsulfonylamino)hex-2-enyl]benzoate?
The IUPAC name of methyl 4-[(E,1R)-2-propyl-1-(quinolin-8-ylsulfonylamino)hex-2-enyl]benzoate (CID 44592764) is methyl 4-[(E,1R)-2-propyl-1-(quinolin-8-ylsulfonylamino)hex-2-enyl]benzoate.
What is the SMILES notation for methyl 4-[(E,1R)-2-propyl-1-(quinolin-8-ylsulfonylamino)hex-2-enyl]benzoate?
The canonical SMILES for methyl 4-[(E,1R)-2-propyl-1-(quinolin-8-ylsulfonylamino)hex-2-enyl]benzoate is CCC/C=C(\CCC)[C@@H](NS(=O)(=O)c1cccc2cccnc12)c1ccc(C(=O)OC)cc1.
What is the InChIKey of methyl 4-[(E,1R)-2-propyl-1-(quinolin-8-ylsulfonylamino)hex-2-enyl]benzoate?
The InChIKey is RQLDSLDAEIFKJV-PEHFAQBGSA-N. The full InChI is InChI=1S/C26H30N2O4S/c1-4-6-10-19(9-5-2)24(21-14-16-22(17-15-21)26(29)32-3)28-33(30,31)23-13-7-11-20-12-8-18-27-25(20)23/h7-8,10-18,24,28H,4-6,9H2,1-3H3/b19-10+/t24-/m1/s1.
What are the key properties of methyl 4-[(E,1R)-2-propyl-1-(quinolin-8-ylsulfonylamino)hex-2-enyl]benzoate?
methyl 4-[(E,1R)-2-propyl-1-(quinolin-8-ylsulfonylamino)hex-2-enyl]benzoate has a molecular weight of 466.60 g/mol, XLogP of 5.57, 10 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[(E,1R)-2-propyl-1-(quinolin-8-ylsulfonylamino)hex-2-enyl]benzoate is sourced from PubChem (CID 44592764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).