C20H33N3 — CID 44592810
(1R,2S,6R,11S,13S,14R,21R)-7,19,23-triazahexacyclo[9.9.1.11,13.12,6.07,21.014,19]tricosane (PubChem CID 44592810) has the molecular formula C20H33N3 and a molecular weight of 315.51 g/mol. Its IUPAC name is (1R,2S,6R,11S,13S,14R,21R)-7,19,23-triazahexacyclo[9.9.1.11,13.12,6.07,21.014,19]tricosane.
| Compound Name | (1R,2S,6R,11S,13S,14R,21R)-7,19,23-triazahexacyclo[9.9.1.11,13.12,6.07,21.014,19]tricosane |
|---|---|
| PubChem CID | 44592810 |
| Molecular Formula | C20H33N3 |
| Molecular Weight | 315.51 g/mol |
| Exact Mass | 315.27 |
| IUPAC Name | (1R,2S,6R,11S,13S,14R,21R)-7,19,23-triazahexacyclo[9.9.1.11,13.12,6.07,21.014,19]tricosane |
| SMILES | C1CCN2C[C@]34C[C@H](C[C@@H]5CCCN([C@@H]6CCC[C@@H]3N6)[C@H]54)[C@H]2C1 |
| InChI | InChI=1S/C20H33N3/c1-2-9-22-13-20-12-15(16(22)6-1)11-14-5-4-10-23(19(14)20)18-8-3-7-17(20)21-18/h14-19,21H,1-13H2/t14-,15-,16+,17-,18+,19+,20+/m0/s1 |
| InChIKey | MRLGBUWOAFGOBH-HKFDWYQHSA-N |
| XLogP | 2.81 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.51 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |