About N-[(E,1R)-1-phenyl-2-propylhex-2-enyl]-4-(trifluoromethyl)benzenesulfonamide
N-[(E,1R)-1-phenyl-2-propylhex-2-enyl]-4-(trifluoromethyl)benzenesulfonamide (PubChem CID 44592828) has the molecular formula C22H26F3NO2S
and a molecular weight of 425.52 g/mol. Its IUPAC name is N-[(E,1R)-1-phenyl-2-propylhex-2-enyl]-4-(trifluoromethyl)benzenesulfonamide.
Molecular Properties
| Compound Name | N-[(E,1R)-1-phenyl-2-propylhex-2-enyl]-4-(trifluoromethyl)benzenesulfonamide |
| PubChem CID | 44592828 |
| Molecular Formula | C22H26F3NO2S |
| Molecular Weight | 425.52 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | N-[(E,1R)-1-phenyl-2-propylhex-2-enyl]-4-(trifluoromethyl)benzenesulfonamide |
| SMILES | CCC/C=C(\CCC)[C@@H](NS(=O)(=O)c1ccc(C(F)(F)F)cc1)c1ccccc1 |
| InChI | InChI=1S/C22H26F3NO2S/c1-3-5-10-17(9-4-2)21(18-11-7-6-8-12-18)26-29(27,28)20-15-13-19(14-16-20)22(23,24)25/h6-8,10-16,21,26H,3-5,9H2,1-2H3/b17-10+/t21-/m1/s1 |
| InChIKey | UMLSDBMFYOPPOU-AKCCUMBPSA-N |
| XLogP | 6.25 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 425.52 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[(E,1R)-1-phenyl-2-propylhex-2-enyl]-4-(trifluoromethyl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E,1R)-1-phenyl-2-propylhex-2-enyl]-4-(trifluoromethyl)benzenesulfonamide?
The IUPAC name of N-[(E,1R)-1-phenyl-2-propylhex-2-enyl]-4-(trifluoromethyl)benzenesulfonamide (CID 44592828) is N-[(E,1R)-1-phenyl-2-propylhex-2-enyl]-4-(trifluoromethyl)benzenesulfonamide.
What is the SMILES notation for N-[(E,1R)-1-phenyl-2-propylhex-2-enyl]-4-(trifluoromethyl)benzenesulfonamide?
The canonical SMILES for N-[(E,1R)-1-phenyl-2-propylhex-2-enyl]-4-(trifluoromethyl)benzenesulfonamide is CCC/C=C(\CCC)[C@@H](NS(=O)(=O)c1ccc(C(F)(F)F)cc1)c1ccccc1.
What is the InChIKey of N-[(E,1R)-1-phenyl-2-propylhex-2-enyl]-4-(trifluoromethyl)benzenesulfonamide?
The InChIKey is UMLSDBMFYOPPOU-AKCCUMBPSA-N. The full InChI is InChI=1S/C22H26F3NO2S/c1-3-5-10-17(9-4-2)21(18-11-7-6-8-12-18)26-29(27,28)20-15-13-19(14-16-20)22(23,24)25/h6-8,10-16,21,26H,3-5,9H2,1-2H3/b17-10+/t21-/m1/s1.
What are the key properties of N-[(E,1R)-1-phenyl-2-propylhex-2-enyl]-4-(trifluoromethyl)benzenesulfonamide?
N-[(E,1R)-1-phenyl-2-propylhex-2-enyl]-4-(trifluoromethyl)benzenesulfonamide has a molecular weight of 425.52 g/mol, XLogP of 6.25, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E,1R)-1-phenyl-2-propylhex-2-enyl]-4-(trifluoromethyl)benzenesulfonamide is sourced from PubChem (CID 44592828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).