C16H25NO2S — CID 44592829
N-[(E,1R)-1-phenyl-2-propylhex-2-enyl]methanesulfonamide (PubChem CID 44592829) has the molecular formula C16H25NO2S and a molecular weight of 295.45 g/mol. Its IUPAC name is N-[(E,1R)-1-phenyl-2-propylhex-2-enyl]methanesulfonamide.
| Compound Name | N-[(E,1R)-1-phenyl-2-propylhex-2-enyl]methanesulfonamide |
|---|---|
| PubChem CID | 44592829 |
| Molecular Formula | C16H25NO2S |
| Molecular Weight | 295.45 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | N-[(E,1R)-1-phenyl-2-propylhex-2-enyl]methanesulfonamide |
| SMILES | CCC/C=C(\CCC)[C@@H](NS(C)(=O)=O)c1ccccc1 |
| InChI | InChI=1S/C16H25NO2S/c1-4-6-11-14(10-5-2)16(17-20(3,18)19)15-12-8-7-9-13-15/h7-9,11-13,16-17H,4-6,10H2,1-3H3/b14-11+/t16-/m1/s1 |
| InChIKey | ASJJDGLPWMMDDJ-WSYSLRRZSA-N |
| XLogP | 3.80 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.45 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|