C22H29ClN2O3 — CID 44592944
methyl (1S,9S,13E)-13-ethylidene-18-(hydroxymethyl)-15-methyl-8-aza-15-azoniapentacyclo[10.5.1.01,9.02,7.09,15]octadeca-2,4,6-triene-18-carboxylate chloride (PubChem CID 44592944) has the molecular formula C22H29ClN2O3 and a molecular weight of 404.94 g/mol. Its IUPAC name is methyl (1S,9S,13E)-13-ethylidene-18-(hydroxymethyl)-15-methyl-8-aza-15-azoniapentacyclo[10.5.1.01,9.02,7.09,15]octadeca-2,4,6-triene-18-carboxylate chloride.
| Compound Name | methyl (1S,9S,13E)-13-ethylidene-18-(hydroxymethyl)-15-methyl-8-aza-15-azoniapentacyclo[10.5.1.01,9.02,7.09,15]octadeca-2,4,6-triene-18-carboxylate chloride |
|---|---|
| PubChem CID | 44592944 |
| Molecular Formula | C22H29ClN2O3 |
| Molecular Weight | 404.94 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | methyl (1S,9S,13E)-13-ethylidene-18-(hydroxymethyl)-15-methyl-8-aza-15-azoniapentacyclo[10.5.1.01,9.02,7.09,15]octadeca-2,4,6-triene-18-carboxylate chloride |
| SMILES | C/C=C1/C[N+]2(C)CC[C@@]34c5ccccc5N[C@]32CCC1C4(CO)C(=O)OC.[Cl-] |
| InChI | InChI=1S/C22H29N2O3.ClH/c1-4-15-13-24(2)12-11-21-17-7-5-6-8-18(17)23-22(21,24)10-9-16(15)20(21,14-25)19(26)27-3;/h4-8,16,23,25H,9-14H2,1-3H3;1H/q+1;/p-1/b15-4-;/t16?,20?,21-,22-,24?;/m0./s1 |
| InChIKey | SDZHFANOSHFWGQ-XUCAWENYSA-M |
| XLogP | -0.58 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.94 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|