About N-(2-aminoethyl)-2,2-difluoroacetamide;hydrochloride
N-(2-aminoethyl)-2,2-difluoroacetamide;hydrochloride (PubChem CID 44592974) has the molecular formula C4H9ClF2N2O
and a molecular weight of 174.58 g/mol. Its IUPAC name is N-(2-aminoethyl)-2,2-difluoroacetamide;hydrochloride.
Molecular Properties
| Compound Name | N-(2-aminoethyl)-2,2-difluoroacetamide;hydrochloride |
| PubChem CID | 44592974 |
| Molecular Formula | C4H9ClF2N2O |
| Molecular Weight | 174.58 g/mol |
| Exact Mass | 174.04 |
| IUPAC Name | N-(2-aminoethyl)-2,2-difluoroacetamide;hydrochloride |
| SMILES | Cl.NCCNC(=O)C(F)F |
| InChI | InChI=1S/C4H8F2N2O.ClH/c5-3(6)4(9)8-2-1-7;/h3H,1-2,7H2,(H,8,9);1H |
| InChIKey | KWZIATUBOCNLNU-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.58 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(2-aminoethyl)-2,2-difluoroacetamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-aminoethyl)-2,2-difluoroacetamide;hydrochloride?
The IUPAC name of N-(2-aminoethyl)-2,2-difluoroacetamide;hydrochloride (CID 44592974) is N-(2-aminoethyl)-2,2-difluoroacetamide;hydrochloride.
What is the SMILES notation for N-(2-aminoethyl)-2,2-difluoroacetamide;hydrochloride?
The canonical SMILES for N-(2-aminoethyl)-2,2-difluoroacetamide;hydrochloride is Cl.NCCNC(=O)C(F)F.
What is the InChIKey of N-(2-aminoethyl)-2,2-difluoroacetamide;hydrochloride?
The InChIKey is KWZIATUBOCNLNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8F2N2O.ClH/c5-3(6)4(9)8-2-1-7;/h3H,1-2,7H2,(H,8,9);1H.
What are the key properties of N-(2-aminoethyl)-2,2-difluoroacetamide;hydrochloride?
N-(2-aminoethyl)-2,2-difluoroacetamide;hydrochloride has a molecular weight of 174.58 g/mol, XLogP of -0.25, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-aminoethyl)-2,2-difluoroacetamide;hydrochloride is sourced from PubChem (CID 44592974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).