C25H45BN2O5 — CID 44592995
tert-butyl N-[(2S)-4-methyl-1-oxo-1-[[(1R)-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]pentan-2-yl]carbamate (PubChem CID 44592995) has the molecular formula C25H45BN2O5 and a molecular weight of 464.46 g/mol. Its IUPAC name is tert-butyl N-[(2S)-4-methyl-1-oxo-1-[[(1R)-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]pentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-4-methyl-1-oxo-1-[[(1R)-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]pentan-2-yl]carbamate |
|---|---|
| PubChem CID | 44592995 |
| Molecular Formula | C25H45BN2O5 |
| Molecular Weight | 464.46 g/mol |
| Exact Mass | 464.34 |
| IUPAC Name | tert-butyl N-[(2S)-4-methyl-1-oxo-1-[[(1R)-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]pentan-2-yl]carbamate |
| SMILES | CCC[C@H](NC(=O)[C@H](CC(C)C)NC(=O)OC(C)(C)C)B1O[C@@H]2C[C@@H]3C[C@@H](C3(C)C)[C@]2(C)O1 |
| InChI | InChI=1S/C25H45BN2O5/c1-10-11-20(26-32-19-14-16-13-18(24(16,7)8)25(19,9)33-26)28-21(29)17(12-15(2)3)27-22(30)31-23(4,5)6/h15-20H,10-14H2,1-9H3,(H,27,30)(H,28,29)/t16-,17-,18-,19+,20-,25-/m0/s1 |
| InChIKey | NLTLNKZHKWWBSL-XEDJGDCNSA-N |
| XLogP | 4.48 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.46 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|