C9H16O3 — CID 44593025
3-[(1E,3E)-hexa-1,3-dienoxy]propane-1,2-diol (PubChem CID 44593025) has the molecular formula C9H16O3 and a molecular weight of 172.22 g/mol. Its IUPAC name is 3-[(1E,3E)-hexa-1,3-dienoxy]propane-1,2-diol.
| Compound Name | 3-[(1E,3E)-hexa-1,3-dienoxy]propane-1,2-diol |
|---|---|
| PubChem CID | 44593025 |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | 3-[(1E,3E)-hexa-1,3-dienoxy]propane-1,2-diol |
| SMILES | CC/C=C/C=C/OCC(O)CO |
| InChI | InChI=1S/C9H16O3/c1-2-3-4-5-6-12-8-9(11)7-10/h3-6,9-11H,2,7-8H2,1H3/b4-3+,6-5+ |
| InChIKey | IOWZFEODXQZVRF-VNKDHWASSA-N |
| XLogP | 0.84 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|