About (2S)-3-(4-chloro-2,6-dimethylphenoxy)-2-methylpropan-1-amine
(2S)-3-(4-chloro-2,6-dimethylphenoxy)-2-methylpropan-1-amine (PubChem CID 44593043) has the molecular formula C12H18ClNO
and a molecular weight of 227.73 g/mol. Its IUPAC name is (2S)-3-(4-chloro-2,6-dimethylphenoxy)-2-methylpropan-1-amine.
Molecular Properties
| Compound Name | (2S)-3-(4-chloro-2,6-dimethylphenoxy)-2-methylpropan-1-amine |
| PubChem CID | 44593043 |
| Molecular Formula | C12H18ClNO |
| Molecular Weight | 227.73 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | (2S)-3-(4-chloro-2,6-dimethylphenoxy)-2-methylpropan-1-amine |
| SMILES | Cc1cc(Cl)cc(C)c1OC[C@@H](C)CN |
| InChI | InChI=1S/C12H18ClNO/c1-8(6-14)7-15-12-9(2)4-11(13)5-10(12)3/h4-5,8H,6-7,14H2,1-3H3/t8-/m0/s1 |
| InChIKey | JRDPQDGWJJDILR-QMMMGPOBSA-N |
| XLogP | 2.93 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.73 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-3-(4-chloro-2,6-dimethylphenoxy)-2-methylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-3-(4-chloro-2,6-dimethylphenoxy)-2-methylpropan-1-amine?
The IUPAC name of (2S)-3-(4-chloro-2,6-dimethylphenoxy)-2-methylpropan-1-amine (CID 44593043) is (2S)-3-(4-chloro-2,6-dimethylphenoxy)-2-methylpropan-1-amine.
What is the SMILES notation for (2S)-3-(4-chloro-2,6-dimethylphenoxy)-2-methylpropan-1-amine?
The canonical SMILES for (2S)-3-(4-chloro-2,6-dimethylphenoxy)-2-methylpropan-1-amine is Cc1cc(Cl)cc(C)c1OC[C@@H](C)CN.
What is the InChIKey of (2S)-3-(4-chloro-2,6-dimethylphenoxy)-2-methylpropan-1-amine?
The InChIKey is JRDPQDGWJJDILR-QMMMGPOBSA-N. The full InChI is InChI=1S/C12H18ClNO/c1-8(6-14)7-15-12-9(2)4-11(13)5-10(12)3/h4-5,8H,6-7,14H2,1-3H3/t8-/m0/s1.
What are the key properties of (2S)-3-(4-chloro-2,6-dimethylphenoxy)-2-methylpropan-1-amine?
(2S)-3-(4-chloro-2,6-dimethylphenoxy)-2-methylpropan-1-amine has a molecular weight of 227.73 g/mol, XLogP of 2.93, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-3-(4-chloro-2,6-dimethylphenoxy)-2-methylpropan-1-amine is sourced from PubChem (CID 44593043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).