About 1-[(Z)-2-(benzenesulfonyl)-2-chloroethenyl]-2,4-dichlorobenzene
1-[(Z)-2-(benzenesulfonyl)-2-chloroethenyl]-2,4-dichlorobenzene (PubChem CID 44593044) has the molecular formula C14H9Cl3O2S
and a molecular weight of 347.65 g/mol. Its IUPAC name is 1-[(Z)-2-(benzenesulfonyl)-2-chloroethenyl]-2,4-dichlorobenzene.
Molecular Properties
| Compound Name | 1-[(Z)-2-(benzenesulfonyl)-2-chloroethenyl]-2,4-dichlorobenzene |
| PubChem CID | 44593044 |
| Molecular Formula | C14H9Cl3O2S |
| Molecular Weight | 347.65 g/mol |
| Exact Mass | 345.94 |
| IUPAC Name | 1-[(Z)-2-(benzenesulfonyl)-2-chloroethenyl]-2,4-dichlorobenzene |
| SMILES | O=S(=O)(/C(Cl)=C/c1ccc(Cl)cc1Cl)c1ccccc1 |
| InChI | InChI=1S/C14H9Cl3O2S/c15-11-7-6-10(13(16)9-11)8-14(17)20(18,19)12-4-2-1-3-5-12/h1-9H/b14-8+ |
| InChIKey | PXKJXWCSDWYYLH-RIYZIHGNSA-N |
| XLogP | 5.00 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 347.65 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(Z)-2-(benzenesulfonyl)-2-chloroethenyl]-2,4-dichlorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(Z)-2-(benzenesulfonyl)-2-chloroethenyl]-2,4-dichlorobenzene?
The IUPAC name of 1-[(Z)-2-(benzenesulfonyl)-2-chloroethenyl]-2,4-dichlorobenzene (CID 44593044) is 1-[(Z)-2-(benzenesulfonyl)-2-chloroethenyl]-2,4-dichlorobenzene.
What is the SMILES notation for 1-[(Z)-2-(benzenesulfonyl)-2-chloroethenyl]-2,4-dichlorobenzene?
The canonical SMILES for 1-[(Z)-2-(benzenesulfonyl)-2-chloroethenyl]-2,4-dichlorobenzene is O=S(=O)(/C(Cl)=C/c1ccc(Cl)cc1Cl)c1ccccc1.
What is the InChIKey of 1-[(Z)-2-(benzenesulfonyl)-2-chloroethenyl]-2,4-dichlorobenzene?
The InChIKey is PXKJXWCSDWYYLH-RIYZIHGNSA-N. The full InChI is InChI=1S/C14H9Cl3O2S/c15-11-7-6-10(13(16)9-11)8-14(17)20(18,19)12-4-2-1-3-5-12/h1-9H/b14-8+.
What are the key properties of 1-[(Z)-2-(benzenesulfonyl)-2-chloroethenyl]-2,4-dichlorobenzene?
1-[(Z)-2-(benzenesulfonyl)-2-chloroethenyl]-2,4-dichlorobenzene has a molecular weight of 347.65 g/mol, XLogP of 5.00, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(Z)-2-(benzenesulfonyl)-2-chloroethenyl]-2,4-dichlorobenzene is sourced from PubChem (CID 44593044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).